CAS 1111103-75-3

5-[3-(Methylthio)phenyl]-2(1H)-pyrimidinone

Description:

5-[3-(Methylthio)phenyl]-2(1H)-pyrimidinone is an organic compound characterized by its pyrimidinone core, which features a methylthio-substituted phenyl group. The presence of the methylthio group introduces a sulfur atom into the structure, which can influence the compound's reactivity and solubility. This compound typically exhibits properties such as moderate polarity due to the heteroatoms in its structure, which can affect its interactions in biological systems. It may also display potential biological activity, making it of interest in medicinal chemistry. The molecular structure suggests that it could participate in hydrogen bonding and other intermolecular interactions, which are crucial for its behavior in various environments. Additionally, the compound's stability and reactivity can be influenced by the electronic effects of the methylthio group and the overall arrangement of atoms within the pyrimidinone framework. Overall, 5-[3-(Methylthio)phenyl]-2(1H)-pyrimidinone represents a class of compounds that may have applications in pharmaceuticals or agrochemicals, pending further investigation into its specific properties and activities.

Formula: C₁₁H₁₀N₂OS

InChI: InChI=1S/C11H10N2OS/c1-15-10-4-2-3-8(5-10)9-6-12-11(14)13-7-9/h2-7H,1H3,(H,12,13,14)

InChI key: InChIKey=WHNRYTSGPNDIRZ-UHFFFAOYSA-N

SMILES: S(C)C=1C=C(C=CC1)C2=CNC(=O)N=C2

Synonyms:

• 2(1H)-Pyrimidinone, 5-[3-(methylthio)phenyl]-
• 5-[3-(Methylthio)phenyl]-2(1H)-pyrimidinone