CymitQuimica logo

CAS 1111103-80-0

:

5-(2,4-Dimethoxyphenyl)-2(1H)-pyrimidinone

Description:
5-(2,4-Dimethoxyphenyl)-2(1H)-pyrimidinone is an organic compound characterized by its pyrimidinone core, which features a substituted phenyl group. The presence of two methoxy groups on the phenyl ring enhances its electron-donating properties, potentially influencing its reactivity and solubility. This compound typically exhibits a solid-state at room temperature and may have moderate to high polarity due to the functional groups present. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as pyrimidinones are often associated with various biological activities. The compound's CAS number, 1111103-80-0, allows for precise identification in chemical databases and literature. Additionally, its synthesis may involve standard organic reactions such as nucleophilic substitutions or cyclization processes. Overall, the characteristics of this compound make it a subject of interest for further research in both synthetic and applied chemistry contexts.
Formula:C12H12N2O3
InChI:InChI=1S/C12H12N2O3/c1-16-9-3-4-10(11(5-9)17-2)8-6-13-12(15)14-7-8/h3-7H,1-2H3,(H,13,14,15)
InChI key:InChIKey=HOMLXLJXHAWIEL-UHFFFAOYSA-N
SMILES:O(C)C1=C(C=CC(OC)=C1)C2=CNC(=O)N=C2
Synonyms:
  • 5-(2,4-Dimethoxyphenyl)-2(1H)-pyrimidinone
  • 2(1H)-Pyrimidinone, 5-(2,4-dimethoxyphenyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.