CAS 1111103-92-4

5-(4-Fluoro-3-methylphenyl)-2(1H)-pyrimidinone

Description:

5-(4-Fluoro-3-methylphenyl)-2(1H)-pyrimidinone is a chemical compound characterized by its pyrimidinone core, which is a six-membered heterocyclic ring containing nitrogen atoms. The presence of a 4-fluoro-3-methylphenyl group indicates that the compound has a fluorine atom and a methyl group attached to a phenyl ring, which can influence its chemical reactivity and biological activity. This compound may exhibit properties typical of pyrimidinones, such as potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. The fluorine substituent can enhance lipophilicity and metabolic stability, while the methyl group may affect the steric and electronic properties of the molecule. The compound's structure suggests it could interact with biological targets, making it of interest in drug discovery. Additionally, its CAS number, 1111103-92-4, allows for easy identification in chemical databases and literature. Overall, this compound's unique structural features contribute to its potential utility in various chemical and biological applications.

Formula: C₁₁H₉FN₂O

InChI: InChI=1S/C11H9FN2O/c1-7-4-8(2-3-10(7)12)9-5-13-11(15)14-6-9/h2-6H,1H3,(H,13,14,15)

InChI key: InChIKey=QLXFHDAYKMUOCD-UHFFFAOYSA-N

SMILES: CC=1C=C(C=CC1F)C2=CNC(=O)N=C2

Synonyms:

• 2(1H)-Pyrimidinone, 5-(4-fluoro-3-methylphenyl)-
• 5-(4-Fluoro-3-methylphenyl)-2(1H)-pyrimidinone