
CAS 1111104-00-7
:5-[2-(Trifluoromethyl)phenyl]-2(1H)-pyrimidinone
Description:
5-[2-(Trifluoromethyl)phenyl]-2(1H)-pyrimidinone is a chemical compound characterized by its pyrimidinone core, which features a trifluoromethyl-substituted phenyl group. This structure contributes to its unique chemical properties, including potential lipophilicity due to the presence of the trifluoromethyl group, which can enhance the compound's biological activity and interaction with various targets. The compound is likely to exhibit moderate to high stability under standard conditions, but its reactivity can be influenced by the electron-withdrawing nature of the trifluoromethyl group. Additionally, the presence of the pyrimidinone moiety suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as pyrimidine derivatives are often associated with various biological activities. The compound's solubility, melting point, and other physical properties would depend on its specific molecular interactions and the presence of functional groups. Overall, 5-[2-(Trifluoromethyl)phenyl]-2(1H)-pyrimidinone represents a versatile structure with potential implications in drug design and development.
Formula:C11H7F3N2O
InChI:InChI=1S/C11H7F3N2O/c12-11(13,14)9-4-2-1-3-8(9)7-5-15-10(17)16-6-7/h1-6H,(H,15,16,17)
InChI key:InChIKey=XLMLWWXAAQIKCB-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C1=C(C=CC=C1)C2=CNC(=O)N=C2
Synonyms:- 5-[2-(Trifluoromethyl)phenyl]-2(1H)-pyrimidinone
- 2(1H)-Pyrimidinone, 5-[2-(trifluoromethyl)phenyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.