CymitQuimica logo

CAS 1111104-12-1

:

5-[3-(Hydroxymethyl)phenyl]-2(1H)-pyrimidinone

Description:
5-[3-(Hydroxymethyl)phenyl]-2(1H)-pyrimidinone, with the CAS number 1111104-12-1, is an organic compound characterized by its pyrimidinone core structure, which features a pyrimidine ring with a carbonyl group and a hydroxymethyl-substituted phenyl group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, including potential solubility in polar solvents due to the presence of hydroxymethyl groups. Its molecular structure suggests it may participate in hydrogen bonding, influencing its reactivity and interaction with biological systems. The presence of the hydroxymethyl group can enhance its potential as a pharmacophore, making it of interest in medicinal chemistry for developing therapeutic agents. Additionally, the compound may exhibit various biological activities, which would require further investigation through experimental studies. Overall, its unique structural features position it as a candidate for research in organic synthesis and drug development.
Formula:C11H10N2O2
InChI:InChI=1S/C11H10N2O2/c14-7-8-2-1-3-9(4-8)10-5-12-11(15)13-6-10/h1-6,14H,7H2,(H,12,13,15)
InChI key:InChIKey=BQNOEXYFUBUERJ-UHFFFAOYSA-N
SMILES:C(O)C=1C=C(C=CC1)C2=CNC(=O)N=C2
Synonyms:
  • 5-[3-(Hydroxymethyl)phenyl]-2(1H)-pyrimidinone
  • 2(1H)-Pyrimidinone, 5-[3-(hydroxymethyl)phenyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.