CymitQuimica logo

CAS 1111104-23-4

:

5-(2-Chloro-5-methoxyphenyl)-2(1H)-pyrimidinone

Description:
5-(2-Chloro-5-methoxyphenyl)-2(1H)-pyrimidinone is a chemical compound characterized by its pyrimidinone core, which features a chloro and a methoxy substituent on a phenyl ring. The presence of the chloro group typically enhances the compound's reactivity and may influence its biological activity, while the methoxy group can affect its solubility and electronic properties. This compound is likely to exhibit properties typical of pyrimidinones, such as potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. Its structure suggests it may interact with biological targets, possibly serving as an enzyme inhibitor or a modulator of cellular pathways. The compound's molecular weight, solubility, and stability would depend on the specific arrangement of its functional groups and the overall molecular structure. As with many organic compounds, its synthesis, purification, and characterization would be essential for understanding its potential applications and behavior in various chemical environments.
Formula:C11H9ClN2O2
InChI:InChI=1S/C11H9ClN2O2/c1-16-8-2-3-10(12)9(4-8)7-5-13-11(15)14-6-7/h2-6H,1H3,(H,13,14,15)
InChI key:InChIKey=PSLBRDPKFQGQBL-UHFFFAOYSA-N
SMILES:ClC=1C(=CC(OC)=CC1)C2=CNC(=O)N=C2
Synonyms:
  • 5-(2-Chloro-5-methoxyphenyl)-2(1H)-pyrimidinone
  • 2(1H)-Pyrimidinone, 5-(2-chloro-5-methoxyphenyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.