CAS 1111104-25-6

5-(5-Chloro-2-methoxyphenyl)-2(1H)-pyrimidinone

Description:

5-(5-Chloro-2-methoxyphenyl)-2(1H)-pyrimidinone is a chemical compound characterized by its pyrimidinone core, which is a six-membered heterocyclic ring containing nitrogen atoms. The presence of a chloro group and a methoxy group on the phenyl ring contributes to its unique reactivity and solubility properties. This compound typically exhibits moderate to high lipophilicity due to the aromatic substituents, which can influence its biological activity and interaction with various biological targets. It may also display potential as a pharmaceutical agent, given the structural motifs often associated with bioactive compounds. The molecular structure suggests that it could participate in hydrogen bonding and other intermolecular interactions, which are crucial for its function in biological systems. Additionally, the compound's stability and reactivity can be affected by environmental factors such as pH and temperature. Overall, 5-(5-Chloro-2-methoxyphenyl)-2(1H)-pyrimidinone is of interest in medicinal chemistry and may serve as a lead compound for further drug development.

Formula: C₁₁H₉ClN₂O₂

InChI: InChI=1S/C11H9ClN2O2/c1-16-10-3-2-8(12)4-9(10)7-5-13-11(15)14-6-7/h2-6H,1H3,(H,13,14,15)

InChI key: InChIKey=PVTAXJLYTFZEKB-UHFFFAOYSA-N

SMILES: O(C)C1=C(C=C(Cl)C=C1)C2=CNC(=O)N=C2

Synonyms:

• 5-(5-Chloro-2-methoxyphenyl)-2(1H)-pyrimidinone
• 2(1H)-Pyrimidinone, 5-(5-chloro-2-methoxyphenyl)-