
CAS 1111105-38-4
:4-(1,6-Dihydro-6-oxo-2-pyridinyl)benzaldehyde
Description:
4-(1,6-Dihydro-6-oxo-2-pyridinyl)benzaldehyde is an organic compound characterized by its structure, which features a benzaldehyde moiety linked to a pyridine derivative. The presence of the 1,6-dihydro-6-oxo-2-pyridinyl group indicates that the compound contains a pyridine ring with a ketone functional group, contributing to its reactivity and potential biological activity. This compound may exhibit properties such as being a potential ligand in coordination chemistry or a precursor in organic synthesis. Its molecular structure suggests it could participate in various chemical reactions, including nucleophilic additions and condensation reactions, due to the electrophilic nature of the aldehyde group. Additionally, the compound may possess interesting pharmacological properties, making it a candidate for further research in medicinal chemistry. As with many organic compounds, its solubility, stability, and reactivity can be influenced by environmental factors such as pH and temperature. Safety data and handling precautions should be considered when working with this substance in a laboratory setting.
Formula:C12H9NO2
InChI:InChI=1S/C12H9NO2/c14-8-9-4-6-10(7-5-9)11-2-1-3-12(15)13-11/h1-8H,(H,13,15)
InChI key:InChIKey=WIPSXGAPNCHQLQ-UHFFFAOYSA-N
SMILES:O=C1NC(=CC=C1)C2=CC=C(C=O)C=C2
Synonyms:- 4-(1,6-Dihydro-6-oxo-2-pyridinyl)benzaldehyde
- Benzaldehyde, 4-(1,6-dihydro-6-oxo-2-pyridinyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.