CAS 1111105-39-5

2(1H)-Pyridinone, 6-(3-hydroxyphenyl)-

Description:

2(1H)-Pyridinone, 6-(3-hydroxyphenyl)-, identified by the CAS number 1111105-39-5, is an organic compound characterized by its pyridinone core structure, which features a nitrogen-containing six-membered ring with a carbonyl group and a hydroxyl-substituted phenyl group at the 6-position. This compound exhibits properties typical of both heterocycles and phenolic compounds, including potential hydrogen bonding and aromatic interactions due to the presence of the hydroxyl group. It may display biological activity, making it of interest in medicinal chemistry and drug development. The compound's solubility, stability, and reactivity can be influenced by the functional groups present, particularly the hydroxyl group, which can participate in various chemical reactions. Additionally, its structural features may allow for interactions with biological targets, suggesting potential applications in pharmaceuticals or agrochemicals. As with many organic compounds, its physical properties, such as melting point and boiling point, would need to be determined experimentally for specific applications.

Formula: C₁₁H₉NO₂

InChI: InChI=1S/C11H9NO2/c13-9-4-1-3-8(7-9)10-5-2-6-11(14)12-10/h1-7,13H,(H,12,14)

InChI key: InChIKey=LLQRUCCTKRUDRV-UHFFFAOYSA-N

SMILES: OC=1C=C(C=CC1)C=2NC(=O)C=CC2

Synonyms:

• 2(1H)-Pyridinone, 6-(3-hydroxyphenyl)-