CAS 1111105-47-5

6-(5-Chloro-2-methoxyphenyl)-2(1H)-pyridinone

Description:

6-(5-Chloro-2-methoxyphenyl)-2(1H)-pyridinone, identified by its CAS number 1111105-47-5, is a chemical compound characterized by its unique structural features. It contains a pyridinone core, which is a heterocyclic compound featuring a nitrogen atom in the ring, contributing to its potential biological activity. The presence of a chloro substituent and a methoxy group on the phenyl ring enhances its lipophilicity and may influence its interaction with biological targets. This compound is often studied for its potential pharmacological properties, including anti-inflammatory and antimicrobial activities. Its molecular structure suggests that it may participate in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions, due to the reactive sites provided by the chloro and methoxy groups. Additionally, the compound's solubility and stability in different solvents can vary, which is crucial for its application in medicinal chemistry and drug formulation. Overall, 6-(5-Chloro-2-methoxyphenyl)-2(1H)-pyridinone represents a class of compounds with significant interest in pharmaceutical research.

Formula: C₁₂H₁₀ClNO₂

InChI: InChI=1S/C12H10ClNO2/c1-16-11-6-5-8(13)7-9(11)10-3-2-4-12(15)14-10/h2-7H,1H3,(H,14,15)

InChI key: InChIKey=RTBXDEUWGHYUNY-UHFFFAOYSA-N

SMILES: O(C)C1=C(C=C(Cl)C=C1)C=2NC(=O)C=CC2

Synonyms:

• 6-(5-Chloro-2-methoxyphenyl)-2(1H)-pyridinone
• 2(1H)-Pyridinone, 6-(5-chloro-2-methoxyphenyl)-