CAS 1111107-98-2

5-(2-Chloro-4-methylphenyl)-2(1H)-pyrimidinone

Description:

5-(2-Chloro-4-methylphenyl)-2(1H)-pyrimidinone is a chemical compound characterized by its pyrimidinone core, which features a chlorine substituent and a methyl group on a phenyl ring. This compound typically exhibits a molecular structure that includes a pyrimidine ring fused with a carbonyl group, contributing to its potential biological activity. The presence of the chlorine atom can influence its reactivity and solubility, while the methyl group may affect its steric properties. This compound is often studied for its potential applications in pharmaceuticals, particularly in the development of drugs targeting specific biological pathways. Its properties, such as melting point, boiling point, and solubility, can vary based on the specific conditions and solvents used. Additionally, the compound's interactions with biological systems can be explored through various assays to determine its efficacy and safety profile. Overall, 5-(2-Chloro-4-methylphenyl)-2(1H)-pyrimidinone represents a class of compounds that may hold significance in medicinal chemistry and drug discovery.

Formula: C₁₁H₉ClN₂O

InChI: InChI=1S/C11H9ClN2O/c1-7-2-3-9(10(12)4-7)8-5-13-11(15)14-6-8/h2-6H,1H3,(H,13,14,15)

InChI key: InChIKey=UTCLBDJWFUDSDB-UHFFFAOYSA-N

SMILES: ClC1=C(C2=CNC(=O)N=C2)C=CC(C)=C1

Synonyms:

• 2(1H)-Pyrimidinone, 5-(2-chloro-4-methylphenyl)-
• 5-(2-Chloro-4-methylphenyl)-2(1H)-pyrimidinone