
CAS 1111108-16-7
:5-[3-(Phenylmethoxy)phenyl]-2(1H)-pyrimidinone
Description:
5-[3-(Phenylmethoxy)phenyl]-2(1H)-pyrimidinone, identified by its CAS number 1111108-16-7, is a chemical compound that belongs to the class of pyrimidinones, which are characterized by a six-membered ring containing two nitrogen atoms at positions 1 and 3. This compound features a pyrimidinone core substituted with a phenylmethoxy group, which enhances its lipophilicity and may influence its biological activity. The presence of the phenyl groups suggests potential interactions with various biological targets, making it of interest in medicinal chemistry. The compound's structure may confer specific properties such as solubility, stability, and reactivity, which are critical for its application in pharmaceuticals or as a research chemical. Additionally, the molecular interactions facilitated by the phenylmethoxy substituent could play a role in its pharmacokinetics and pharmacodynamics. Overall, this compound's unique structural features position it as a candidate for further investigation in drug development and related fields.
Formula:C17H14N2O2
InChI:InChI=1S/C17H14N2O2/c20-17-18-10-15(11-19-17)14-7-4-8-16(9-14)21-12-13-5-2-1-3-6-13/h1-11H,12H2,(H,18,19,20)
InChI key:InChIKey=BIBJZPBPNUEQSY-UHFFFAOYSA-N
SMILES:O(CC1=CC=CC=C1)C=2C=C(C=CC2)C3=CNC(=O)N=C3
Synonyms:- 2(1H)-Pyrimidinone, 5-[3-(phenylmethoxy)phenyl]-
- 5-[3-(Phenylmethoxy)phenyl]-2(1H)-pyrimidinone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.