
CAS 1111108-20-3
:5-(2,6-Difluorophenyl)-2(1H)-pyrimidinone
Description:
5-(2,6-Difluorophenyl)-2(1H)-pyrimidinone, identified by its CAS number 1111108-20-3, is a chemical compound characterized by its pyrimidinone core structure, which features a pyrimidine ring substituted with a difluorophenyl group. This compound typically exhibits properties associated with heterocyclic compounds, including potential biological activity due to its structural motifs. The presence of fluorine atoms can enhance lipophilicity and influence the compound's interaction with biological targets. It may be utilized in medicinal chemistry for the development of pharmaceuticals, particularly in the context of targeting specific enzymes or receptors. The compound's solubility, stability, and reactivity can vary based on its functional groups and the overall molecular structure. Additionally, its synthesis may involve standard organic reactions such as nucleophilic substitutions or cyclization processes. As with many pyrimidine derivatives, it may exhibit a range of biological activities, making it of interest in drug discovery and development.
Formula:C10H6F2N2O
InChI:InChI=1S/C10H6F2N2O/c11-7-2-1-3-8(12)9(7)6-4-13-10(15)14-5-6/h1-5H,(H,13,14,15)
InChI key:InChIKey=LBCXHVGUNKYMRS-UHFFFAOYSA-N
SMILES:FC1=C(C(F)=CC=C1)C2=CNC(=O)N=C2
Synonyms:- 2(1H)-Pyrimidinone, 5-(2,6-difluorophenyl)-
- 5-(2,6-Difluorophenyl)-2(1H)-pyrimidinone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.