CAS 1111108-38-3

5-(3,5-Dimethylphenyl)-2(1H)-pyrimidinone

Description:

5-(3,5-Dimethylphenyl)-2(1H)-pyrimidinone is an organic compound characterized by its pyrimidinone core, which features a pyrimidine ring substituted with a 3,5-dimethylphenyl group. This structure contributes to its potential biological activity, making it of interest in medicinal chemistry. The compound typically exhibits properties such as moderate solubility in organic solvents and may have limited solubility in water, which is common for many organic compounds with aromatic substituents. Its molecular structure suggests the presence of functional groups that can participate in hydrogen bonding, influencing its reactivity and interactions with biological targets. The compound may also display specific spectral characteristics in techniques such as NMR and IR spectroscopy, aiding in its identification and characterization. Additionally, due to its structural features, it may exhibit various pharmacological properties, making it a candidate for further research in drug development. However, detailed studies would be necessary to fully elucidate its properties and potential applications.

Formula: C₁₂H₁₂N₂O

InChI: InChI=1S/C12H12N2O/c1-8-3-9(2)5-10(4-8)11-6-13-12(15)14-7-11/h3-7H,1-2H3,(H,13,14,15)

InChI key: InChIKey=PVRVDMAKCPSRFN-UHFFFAOYSA-N

SMILES: CC=1C=C(C=C(C)C1)C2=CNC(=O)N=C2

Synonyms:

• 5-(3,5-Dimethylphenyl)-2(1H)-pyrimidinone
• 2(1H)-Pyrimidinone, 5-(3,5-dimethylphenyl)-