CAS 1111108-44-1

5-(3-Chloro-4-methylphenyl)-2(1H)-pyrimidinone

Description:

5-(3-Chloro-4-methylphenyl)-2(1H)-pyrimidinone is a chemical compound characterized by its pyrimidinone core, which features a pyrimidine ring substituted with a phenyl group that contains a chlorine atom and a methyl group. The presence of the chloro and methyl substituents on the phenyl ring influences the compound's reactivity and solubility properties. This compound is typically classified as an organic heterocyclic compound due to the nitrogen atoms in the pyrimidine ring. It may exhibit biological activity, making it of interest in medicinal chemistry and pharmaceutical research. The molecular structure suggests potential interactions with biological targets, which could lead to applications in drug development. Additionally, the compound's stability, solubility in various solvents, and potential for forming derivatives are important characteristics that can affect its utility in various chemical and biological contexts. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.

Formula: C₁₁H₉ClN₂O

InChI: InChI=1S/C11H9ClN2O/c1-7-2-3-8(4-10(7)12)9-5-13-11(15)14-6-9/h2-6H,1H3,(H,13,14,15)

InChI key: InChIKey=JWXKDIHAIBWIBU-UHFFFAOYSA-N

SMILES: ClC=1C=C(C=CC1C)C2=CNC(=O)N=C2

Synonyms:

• 2(1H)-Pyrimidinone, 5-(3-chloro-4-methylphenyl)-
• 5-(3-Chloro-4-methylphenyl)-2(1H)-pyrimidinone