CymitQuimica logo

CAS 1111108-58-7

:

5-(2,4,6-Trifluorophenyl)-2(1H)-pyrimidinone

Description:
5-(2,4,6-Trifluorophenyl)-2(1H)-pyrimidinone is a chemical compound characterized by its pyrimidinone core structure, which features a pyrimidine ring substituted with a trifluorophenyl group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, including potential biological activity due to the presence of the trifluorophenyl moiety, which can enhance lipophilicity and influence interactions with biological targets. The trifluoromethyl groups contribute to its stability and may affect its reactivity and solubility in various solvents. Additionally, the presence of the carbonyl group in the pyrimidinone structure can participate in hydrogen bonding, influencing its behavior in chemical reactions and interactions. This compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to its potential as a scaffold for drug design. Its specific applications and biological activities would depend on further studies and evaluations in relevant chemical and biological contexts.
Formula:C10H5F3N2O
InChI:InChI=1S/C10H5F3N2O/c11-6-1-7(12)9(8(13)2-6)5-3-14-10(16)15-4-5/h1-4H,(H,14,15,16)
InChI key:InChIKey=NFUCEDMIGXRJAP-UHFFFAOYSA-N
SMILES:FC1=C(C(F)=CC(F)=C1)C2=CNC(=O)N=C2
Synonyms:
  • 5-(2,4,6-Trifluorophenyl)-2(1H)-pyrimidinone
  • 2(1H)-Pyrimidinone, 5-(2,4,6-trifluorophenyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.