
CAS 1111108-60-1
:5-(2,3-Dimethylphenyl)-2(1H)-pyrimidinone
Description:
5-(2,3-Dimethylphenyl)-2(1H)-pyrimidinone is an organic compound characterized by its pyrimidinone core, which features a pyrimidine ring with a carbonyl group and an amine. The presence of the 2,3-dimethylphenyl substituent contributes to its unique properties, including potential hydrophobic interactions due to the aromatic nature of the phenyl group. This compound may exhibit various biological activities, making it of interest in medicinal chemistry and drug development. Its molecular structure suggests it could participate in hydrogen bonding and π-π stacking interactions, which are significant in biological systems. The compound's solubility, stability, and reactivity can be influenced by the substituents on the pyrimidine ring and the phenyl group. Additionally, its synthesis may involve standard organic reactions such as condensation or cyclization. Overall, 5-(2,3-Dimethylphenyl)-2(1H)-pyrimidinone represents a class of compounds that could have applications in pharmaceuticals or agrochemicals, depending on its specific biological activity and interaction with target molecules.
Formula:C12H12N2O
InChI:InChI=1S/C12H12N2O/c1-8-4-3-5-11(9(8)2)10-6-13-12(15)14-7-10/h3-7H,1-2H3,(H,13,14,15)
InChI key:InChIKey=AWKBFLSZEOVZSV-UHFFFAOYSA-N
SMILES:CC1=C(C=CC=C1C)C2=CNC(=O)N=C2
Synonyms:- 5-(2,3-Dimethylphenyl)-2(1H)-pyrimidinone
- 2(1H)-Pyrimidinone, 5-(2,3-dimethylphenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.