
CAS 1111108-67-8
:5-(3,5-Dimethoxyphenyl)-2(1H)-pyrimidinone
Description:
5-(3,5-Dimethoxyphenyl)-2(1H)-pyrimidinone, identified by its CAS number 1111108-67-8, is a chemical compound characterized by its pyrimidinone core structure, which features a pyrimidine ring with a ketone functional group. The presence of the 3,5-dimethoxyphenyl substituent indicates that the compound has two methoxy groups (-OCH3) attached to a phenyl ring, enhancing its lipophilicity and potentially influencing its biological activity. This compound may exhibit properties such as antioxidant, anti-inflammatory, or anticancer activities, which are common in pyrimidine derivatives. Its molecular structure suggests it could participate in various chemical reactions, including nucleophilic substitutions or electrophilic aromatic substitutions, due to the reactivity of the pyrimidinone and phenyl moieties. Additionally, the compound's solubility, stability, and reactivity can be influenced by the methoxy groups, which can also affect its interaction with biological targets. Overall, 5-(3,5-Dimethoxyphenyl)-2(1H)-pyrimidinone is of interest in medicinal chemistry for its potential therapeutic applications.
Formula:C12H12N2O3
InChI:InChI=1S/C12H12N2O3/c1-16-10-3-8(4-11(5-10)17-2)9-6-13-12(15)14-7-9/h3-7H,1-2H3,(H,13,14,15)
InChI key:InChIKey=JBWVXZXYLVVUSW-UHFFFAOYSA-N
SMILES:O(C)C=1C=C(C=C(OC)C1)C2=CNC(=O)N=C2
Synonyms:- 5-(3,5-Dimethoxyphenyl)-2(1H)-pyrimidinone
- 2(1H)-Pyrimidinone, 5-(3,5-dimethoxyphenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.