CAS 1111108-75-8

5-(4-Chloro-2-methylphenyl)-2(1H)-pyrimidinone

Description:

5-(4-Chloro-2-methylphenyl)-2(1H)-pyrimidinone is a chemical compound characterized by its pyrimidinone core, which features a chlorine-substituted aromatic ring. The presence of the 4-chloro and 2-methyl groups on the phenyl ring contributes to its unique chemical properties, influencing its reactivity and potential biological activity. This compound typically exhibits moderate solubility in organic solvents, while its solubility in water may be limited due to the hydrophobic nature of the aromatic system. The pyrimidinone moiety suggests potential applications in medicinal chemistry, as pyrimidine derivatives are often explored for their pharmacological properties, including antimicrobial and anticancer activities. The compound's structure allows for various functional group modifications, which can enhance its biological efficacy or alter its physicochemical properties. As with many organic compounds, safety and handling precautions should be observed, as the presence of chlorine may impart toxicity or environmental concerns. Overall, 5-(4-Chloro-2-methylphenyl)-2(1H)-pyrimidinone represents a versatile scaffold for further chemical exploration and development.

Formula: C₁₁H₉ClN₂O

InChI: InChI=1S/C11H9ClN2O/c1-7-4-9(12)2-3-10(7)8-5-13-11(15)14-6-8/h2-6H,1H3,(H,13,14,15)

InChI key: InChIKey=XFAKAVORGFLKDZ-UHFFFAOYSA-N

SMILES: CC1=C(C2=CNC(=O)N=C2)C=CC(Cl)=C1

Synonyms:

• 2(1H)-Pyrimidinone, 5-(4-chloro-2-methylphenyl)-
• 5-(4-Chloro-2-methylphenyl)-2(1H)-pyrimidinone