CAS 1111109-31-9

5-(2-Chloro-4-methylphenyl)-2(1H)-pyridinone

Description:

5-(2-Chloro-4-methylphenyl)-2(1H)-pyridinone, identified by its CAS number 1111109-31-9, is a chemical compound characterized by its unique structural features. It contains a pyridinone core, which is a heterocyclic compound featuring a nitrogen atom within a six-membered ring that also includes a carbonyl group. The presence of a 2-chloro-4-methylphenyl substituent indicates that the compound has a chlorine atom and a methyl group attached to a phenyl ring, contributing to its overall hydrophobic character. This compound may exhibit biological activity, potentially serving as a scaffold for drug development or as a research tool in medicinal chemistry. Its solubility, stability, and reactivity can vary based on environmental conditions and the presence of other functional groups. As with many organic compounds, safety data should be consulted to understand its handling and potential hazards. Overall, 5-(2-Chloro-4-methylphenyl)-2(1H)-pyridinone represents a class of compounds that may have significant applications in pharmaceuticals or agrochemicals.

Formula: C₁₂H₁₀ClNO

InChI: InChI=1S/C12H10ClNO/c1-8-2-4-10(11(13)6-8)9-3-5-12(15)14-7-9/h2-7H,1H3,(H,14,15)

InChI key: InChIKey=ZRXKQEVVWCSPRF-UHFFFAOYSA-N

SMILES: ClC1=C(C=2C=CC(=O)NC2)C=CC(C)=C1

Synonyms:

• 5-(2-Chloro-4-methylphenyl)-2(1H)-pyridinone
• 2(1H)-Pyridinone, 5-(2-chloro-4-methylphenyl)-