
CAS 1111109-32-0
:5-[4-(Phenylmethoxy)phenyl]-2(1H)-pyridinone
Description:
5-[4-(Phenylmethoxy)phenyl]-2(1H)-pyridinone, identified by its CAS number 1111109-32-0, is a chemical compound characterized by its unique structural features, which include a pyridinone core substituted with a phenylmethoxy group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential for various chemical reactions. The presence of the phenylmethoxy group enhances its lipophilicity, which may influence its solubility in organic solvents and biological systems. Additionally, the compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its molecular structure suggests potential interactions with biological targets, which could be explored for therapeutic applications. Overall, 5-[4-(Phenylmethoxy)phenyl]-2(1H)-pyridinone represents a class of compounds that may possess significant chemical and pharmacological properties, warranting further investigation in both synthetic and applied chemistry contexts.
Formula:C18H15NO2
InChI:InChI=1S/C18H15NO2/c20-18-11-8-16(12-19-18)15-6-9-17(10-7-15)21-13-14-4-2-1-3-5-14/h1-12H,13H2,(H,19,20)
InChI key:InChIKey=SDNFDJVCMOLMOW-UHFFFAOYSA-N
SMILES:O(CC1=CC=CC=C1)C2=CC=C(C=C2)C=3C=CC(=O)NC3
Synonyms:- 2(1H)-Pyridinone, 5-[4-(phenylmethoxy)phenyl]-
- 5-[4-(Phenylmethoxy)phenyl]-2(1H)-pyridinone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.