CAS 1111109-41-1

5-(3,4-Dichlorophenyl)-2(1H)-pyridinone

Description:

5-(3,4-Dichlorophenyl)-2(1H)-pyridinone, identified by its CAS number 1111109-41-1, is a chemical compound characterized by its pyridinone structure, which features a pyridine ring fused with a carbonyl group. The presence of the 3,4-dichlorophenyl group indicates that the compound has two chlorine substituents on the phenyl ring, which can significantly influence its chemical reactivity and biological activity. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific conditions. Its molecular structure suggests potential applications in pharmaceuticals, particularly in the development of compounds with antimicrobial or anti-inflammatory properties. The dichlorophenyl moiety may enhance the lipophilicity of the molecule, potentially affecting its pharmacokinetics. As with many organic compounds, safety data should be consulted to understand its toxicity and handling requirements. Overall, 5-(3,4-Dichlorophenyl)-2(1H)-pyridinone represents a class of compounds that may be of interest in medicinal chemistry and material science.

Formula: C₁₁H₇Cl₂NO

InChI: InChI=1S/C11H7Cl2NO/c12-9-3-1-7(5-10(9)13)8-2-4-11(15)14-6-8/h1-6H,(H,14,15)

InChI key: InChIKey=FGQRHLJHTRZGIB-UHFFFAOYSA-N

SMILES: ClC=1C=C(C=CC1Cl)C=2C=CC(=O)NC2

Synonyms:

• 5-(3,4-Dichlorophenyl)-2(1H)-pyridinone
• 2(1H)-Pyridinone, 5-(3,4-dichlorophenyl)-