
CAS 1111109-48-8
:5-[3-(Phenylmethoxy)phenyl]-2(1H)-pyridinone
Description:
5-[3-(Phenylmethoxy)phenyl]-2(1H)-pyridinone, identified by its CAS number 1111109-48-8, is an organic compound characterized by its complex structure that includes a pyridinone core and a phenylmethoxy substituent. This compound features a pyridine ring fused with a carbonyl group, contributing to its potential as a bioactive molecule. The presence of the phenylmethoxy group enhances its lipophilicity, which can influence its solubility and interaction with biological membranes. Typically, compounds of this nature may exhibit various pharmacological properties, including anti-inflammatory or anticancer activities, although specific biological data would be necessary to confirm such effects. The molecular structure suggests potential for hydrogen bonding and π-π interactions, which could play a role in its reactivity and binding affinity in biological systems. Additionally, the compound's stability and reactivity can be influenced by environmental factors such as pH and temperature, making it of interest in both synthetic and medicinal chemistry contexts.
Formula:C18H15NO2
InChI:InChI=1S/C18H15NO2/c20-18-10-9-16(12-19-18)15-7-4-8-17(11-15)21-13-14-5-2-1-3-6-14/h1-12H,13H2,(H,19,20)
InChI key:InChIKey=OCPURGLIHGJSJV-UHFFFAOYSA-N
SMILES:O(CC1=CC=CC=C1)C=2C=C(C=CC2)C=3C=CC(=O)NC3
Synonyms:- 5-[3-(Phenylmethoxy)phenyl]-2(1H)-pyridinone
- 2(1H)-Pyridinone, 5-[3-(phenylmethoxy)phenyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.