
CAS 1111109-59-1
:5-(2-Fluoro-5-methylphenyl)-2(1H)-pyridinone
Description:
5-(2-Fluoro-5-methylphenyl)-2(1H)-pyridinone, identified by its CAS number 1111109-59-1, is a chemical compound that features a pyridinone core substituted with a fluoro and a methylphenyl group. This compound typically exhibits characteristics common to pyridinones, such as the ability to participate in hydrogen bonding due to the presence of the carbonyl group and nitrogen atom in the pyridine ring. The fluorine atom can influence the compound's electronic properties, potentially enhancing its reactivity and lipophilicity. Additionally, the methyl group on the phenyl ring may affect the steric hindrance and overall molecular conformation. Such compounds are often of interest in medicinal chemistry due to their potential biological activity, including antimicrobial or anti-inflammatory properties. The presence of the fluorine substituent may also enhance metabolic stability and bioavailability. Overall, this compound's unique structural features contribute to its potential applications in pharmaceuticals and agrochemicals.
Formula:C12H10FNO
InChI:InChI=1S/C12H10FNO/c1-8-2-4-11(13)10(6-8)9-3-5-12(15)14-7-9/h2-7H,1H3,(H,14,15)
InChI key:InChIKey=WYPNBYIIJCDTAE-UHFFFAOYSA-N
SMILES:FC1=C(C=C(C)C=C1)C=2C=CC(=O)NC2
Synonyms:- 2(1H)-Pyridinone, 5-(2-fluoro-5-methylphenyl)-
- 5-(2-Fluoro-5-methylphenyl)-2(1H)-pyridinone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.