
CAS 1111109-63-7
:5-(3-Fluoro-4-methylphenyl)-2(1H)-pyridinone
Description:
5-(3-Fluoro-4-methylphenyl)-2(1H)-pyridinone, identified by its CAS number 1111109-63-7, is an organic compound characterized by its pyridinone core structure, which features a pyridine ring fused with a ketone. The presence of a 3-fluoro-4-methylphenyl substituent indicates that the compound has a fluorine atom and a methyl group attached to the aromatic ring, influencing its chemical reactivity and physical properties. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its molecular structure suggests potential interactions with biological targets, possibly affecting its pharmacological profile. The fluorine atom can enhance lipophilicity and metabolic stability, while the methyl group may influence steric effects. Additionally, the compound's solubility, melting point, and stability under various conditions would be essential characteristics to consider in practical applications. Overall, 5-(3-Fluoro-4-methylphenyl)-2(1H)-pyridinone represents a class of compounds that may have significant implications in pharmaceutical research.
Formula:C12H10FNO
InChI:InChI=1S/C12H10FNO/c1-8-2-3-9(6-11(8)13)10-4-5-12(15)14-7-10/h2-7H,1H3,(H,14,15)
InChI key:InChIKey=YUEDOUMWPRNETC-UHFFFAOYSA-N
SMILES:FC=1C=C(C=CC1C)C=2C=CC(=O)NC2
Synonyms:- 2(1H)-Pyridinone, 5-(3-fluoro-4-methylphenyl)-
- 5-(3-Fluoro-4-methylphenyl)-2(1H)-pyridinone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.