CymitQuimica logo

CAS 1111109-94-4

:

5-(2,3-Dimethylphenyl)-2(1H)-pyridinone

Description:
5-(2,3-Dimethylphenyl)-2(1H)-pyridinone, identified by its CAS number 1111109-94-4, is an organic compound characterized by its pyridinone core structure, which features a pyridine ring fused with a carbonyl group. This compound exhibits a distinctive aromatic character due to the presence of the 2,3-dimethylphenyl substituent, which contributes to its hydrophobic properties. The presence of the carbonyl group in the pyridinone structure allows for potential hydrogen bonding and reactivity, making it a candidate for various chemical reactions, including nucleophilic attacks. Its molecular structure suggests that it may exhibit biological activity, potentially serving as a scaffold for drug development or as a ligand in coordination chemistry. Additionally, the compound's solubility and stability can be influenced by the substituents on the aromatic ring, which can affect its interactions in biological systems or materials science applications. Overall, 5-(2,3-Dimethylphenyl)-2(1H)-pyridinone is a versatile compound with potential applications in pharmaceuticals and organic synthesis.
Formula:C13H13NO
InChI:InChI=1S/C13H13NO/c1-9-4-3-5-12(10(9)2)11-6-7-13(15)14-8-11/h3-8H,1-2H3,(H,14,15)
InChI key:InChIKey=HRFBSRJWHOOCBQ-UHFFFAOYSA-N
SMILES:CC1=C(C=CC=C1C)C=2C=CC(=O)NC2
Synonyms:
  • 5-(2,3-Dimethylphenyl)-2(1H)-pyridinone
  • 2(1H)-Pyridinone, 5-(2,3-dimethylphenyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.