
CAS 1111110-08-7
:5-(4-Chloro-2-methylphenyl)-2(1H)-pyridinone
Description:
5-(4-Chloro-2-methylphenyl)-2(1H)-pyridinone is an organic compound characterized by its pyridinone core, which features a chloro-substituted aromatic ring. The presence of the 4-chloro and 2-methyl groups on the phenyl ring contributes to its unique chemical properties, including potential reactivity and solubility characteristics. This compound typically exhibits a moderate polarity due to the combination of the polar pyridinone functional group and the non-polar aromatic ring. It may participate in various chemical reactions, such as nucleophilic substitutions or electrophilic aromatic substitutions, depending on the reaction conditions. Additionally, the compound's structure suggests potential biological activity, making it of interest in medicinal chemistry and drug development. Its specific interactions with biological targets would depend on the substituents' positions and electronic effects. As with many organic compounds, safety and handling precautions should be observed, as it may pose health risks or environmental hazards.
Formula:C12H10ClNO
InChI:InChI=1S/C12H10ClNO/c1-8-6-10(13)3-4-11(8)9-2-5-12(15)14-7-9/h2-7H,1H3,(H,14,15)
InChI key:InChIKey=VNMYKWOYKFSDEW-UHFFFAOYSA-N
SMILES:CC1=C(C=2C=CC(=O)NC2)C=CC(Cl)=C1
Synonyms:- 2(1H)-Pyridinone, 5-(4-chloro-2-methylphenyl)-
- 5-(4-Chloro-2-methylphenyl)-2(1H)-pyridinone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.