CymitQuimica logo

CAS 1111110-51-0

:

6-(2-Methoxy-5-methylphenyl)-2(1H)-pyridinone

Description:
6-(2-Methoxy-5-methylphenyl)-2(1H)-pyridinone is an organic compound characterized by its pyridinone core, which features a methoxy and a methyl-substituted phenyl group. The presence of the pyridinone structure suggests that it may exhibit properties typical of both pyridine and ketone functionalities, including potential basicity and reactivity towards electrophiles. The methoxy group enhances the compound's lipophilicity and may influence its biological activity, while the methyl substitution on the phenyl ring can affect steric hindrance and electronic properties. This compound may be of interest in medicinal chemistry due to its potential pharmacological activities, which could include anti-inflammatory or antimicrobial effects, although specific biological data would be necessary to confirm such activities. Additionally, the compound's solubility, stability, and reactivity can be influenced by the functional groups present, making it a candidate for further research in various chemical applications. As with any chemical substance, safety data and handling precautions should be considered when working with this compound.
Formula:C13H13NO2
InChI:InChI=1S/C13H13NO2/c1-9-6-7-12(16-2)10(8-9)11-4-3-5-13(15)14-11/h3-8H,1-2H3,(H,14,15)
InChI key:InChIKey=VGHUBTKBKPNMTF-UHFFFAOYSA-N
SMILES:O(C)C1=C(C=C(C)C=C1)C=2NC(=O)C=CC2
Synonyms:
  • 2(1H)-Pyridinone, 6-(2-methoxy-5-methylphenyl)-
  • 6-(2-Methoxy-5-methylphenyl)-2(1H)-pyridinone
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.