CymitQuimica logo

CAS 1111110-53-2

:

2(1H)-Pyridinone, 6-[3-(methylthio)phenyl]-

Description:
2(1H)-Pyridinone, 6-[3-(methylthio)phenyl]- is an organic compound characterized by its pyridinone core, which features a nitrogen atom in a six-membered aromatic ring containing a carbonyl group. The presence of a methylthio group attached to a phenyl ring at the 3-position enhances its chemical reactivity and solubility properties. This compound may exhibit biological activity due to its structural features, making it of interest in medicinal chemistry and drug development. Its molecular structure suggests potential interactions with biological targets, which could lead to various pharmacological effects. The compound's properties, such as melting point, boiling point, and solubility, would depend on its specific molecular interactions and the presence of functional groups. Additionally, its synthesis and characterization would typically involve standard organic chemistry techniques, including spectroscopic methods for confirmation of structure. Overall, 2(1H)-Pyridinone, 6-[3-(methylthio)phenyl]- represents a class of compounds that may have significant applications in research and industry.
Formula:C12H11NOS
InChI:InChI=1S/C12H11NOS/c1-15-10-5-2-4-9(8-10)11-6-3-7-12(14)13-11/h2-8H,1H3,(H,13,14)
InChI key:InChIKey=OBFVGRIWFOGRIP-UHFFFAOYSA-N
SMILES:S(C)C=1C=C(C=CC1)C=2NC(=O)C=CC2
Synonyms:
  • 2(1H)-Pyridinone, 6-[3-(methylthio)phenyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.