
CAS 1111110-76-9
:6-(2-Chloro-4-methylphenyl)-2(1H)-pyridinone
Description:
6-(2-Chloro-4-methylphenyl)-2(1H)-pyridinone is an organic compound characterized by its pyridinone core, which features a chlorine substituent and a methyl group on a phenyl ring. The presence of the pyridinone structure indicates that it possesses both basic and acidic properties, making it potentially useful in various chemical reactions and applications. The chlorine atom contributes to the compound's reactivity, influencing its interaction with other chemical species. This compound may exhibit biological activity, which is common among pyridinone derivatives, and could be of interest in medicinal chemistry for its potential therapeutic effects. Its molecular structure suggests it may participate in hydrogen bonding and other intermolecular interactions, affecting its solubility and stability in different solvents. Overall, the characteristics of this compound make it a subject of interest in both synthetic and applied chemistry contexts, particularly in the development of pharmaceuticals or agrochemicals.
Formula:C12H10ClNO
InChI:InChI=1S/C12H10ClNO/c1-8-5-6-9(10(13)7-8)11-3-2-4-12(15)14-11/h2-7H,1H3,(H,14,15)
InChI key:InChIKey=UYKTXSAQEQAUTC-UHFFFAOYSA-N
SMILES:ClC1=C(C=2NC(=O)C=CC2)C=CC(C)=C1
Synonyms:- 2(1H)-Pyridinone, 6-(2-chloro-4-methylphenyl)-
- 6-(2-Chloro-4-methylphenyl)-2(1H)-pyridinone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.