CAS 1111110-84-9

6-(2,3-Dichlorophenyl)-2(1H)-pyridinone

Description:

6-(2,3-Dichlorophenyl)-2(1H)-pyridinone, identified by its CAS number 1111110-84-9, is a chemical compound characterized by its pyridinone structure, which features a pyridine ring fused with a carbonyl group. This compound contains a dichlorophenyl substituent at the 6-position of the pyridinone, indicating the presence of two chlorine atoms on the phenyl ring, specifically at the 2 and 3 positions. The presence of these halogen substituents often influences the compound's reactivity, solubility, and biological activity. Generally, pyridinones are known for their potential applications in pharmaceuticals and agrochemicals due to their ability to interact with biological targets. The dichlorophenyl group can enhance lipophilicity, potentially affecting the compound's absorption and distribution in biological systems. Additionally, the compound may exhibit various properties such as antimicrobial or anti-inflammatory activities, making it of interest in medicinal chemistry. However, specific data regarding its physical properties, such as melting point, boiling point, and solubility, would require further investigation or experimental determination.

Formula: C₁₁H₇Cl₂NO

InChI: InChI=1S/C11H7Cl2NO/c12-8-4-1-3-7(11(8)13)9-5-2-6-10(15)14-9/h1-6H,(H,14,15)

InChI key: InChIKey=VHULXSWSNLMKMM-UHFFFAOYSA-N

SMILES: ClC1=C(C=2NC(=O)C=CC2)C=CC=C1Cl

Synonyms:

• 2(1H)-Pyridinone, 6-(2,3-dichlorophenyl)-
• 6-(2,3-Dichlorophenyl)-2(1H)-pyridinone