CymitQuimica logo

CAS 1111110-85-0

:

6-(3,4-Dichlorophenyl)-2(1H)-pyridinone

Description:
6-(3,4-Dichlorophenyl)-2(1H)-pyridinone is an organic compound characterized by its pyridinone structure, which features a pyridine ring with a ketone functional group. The presence of the 3,4-dichlorophenyl substituent indicates that the compound has two chlorine atoms attached to a phenyl ring, enhancing its potential reactivity and biological activity. This compound may exhibit properties such as being a potential pharmaceutical intermediate or a candidate for agrochemical applications, given the presence of halogen substituents, which often influence lipophilicity and bioactivity. The molecular structure suggests that it may participate in various chemical reactions, including nucleophilic substitutions or electrophilic aromatic substitutions, due to the electron-withdrawing nature of the chlorine atoms. Additionally, the compound's solubility, stability, and reactivity can be influenced by the specific arrangement of its functional groups. Overall, 6-(3,4-Dichlorophenyl)-2(1H)-pyridinone represents a class of compounds that may have significant implications in medicinal chemistry and material science.
Formula:C11H7Cl2NO
InChI:InChI=1S/C11H7Cl2NO/c12-8-5-4-7(6-9(8)13)10-2-1-3-11(15)14-10/h1-6H,(H,14,15)
InChI key:InChIKey=URTAZTMFAAUYEU-UHFFFAOYSA-N
SMILES:ClC=1C=C(C=CC1Cl)C=2NC(=O)C=CC2
Synonyms:
  • 6-(3,4-Dichlorophenyl)-2(1H)-pyridinone
  • 2(1H)-Pyridinone, 6-(3,4-dichlorophenyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.