
CAS 1111110-92-9
:6-[3-(Phenylmethoxy)phenyl]-2(1H)-pyridinone
Description:
6-[3-(Phenylmethoxy)phenyl]-2(1H)-pyridinone is an organic compound characterized by its complex structure, which includes a pyridinone core substituted with a phenylmethoxy group. This compound typically exhibits properties such as moderate solubility in organic solvents and potential biological activity, making it of interest in medicinal chemistry. The presence of the pyridinone moiety suggests that it may participate in hydrogen bonding and exhibit tautomeric behavior, which can influence its reactivity and interaction with biological targets. Additionally, the phenylmethoxy substituent can enhance lipophilicity, potentially affecting the compound's pharmacokinetics. The compound's molecular structure may also allow for various synthetic modifications, making it a versatile candidate for further research in drug development or material science. As with many organic compounds, its stability, reactivity, and potential applications would depend on specific environmental conditions and the presence of other functional groups.
Formula:C18H15NO2
InChI:InChI=1S/C18H15NO2/c20-18-11-5-10-17(19-18)15-8-4-9-16(12-15)21-13-14-6-2-1-3-7-14/h1-12H,13H2,(H,19,20)
InChI key:InChIKey=DVNJAIMKUKNSFH-UHFFFAOYSA-N
SMILES:O(CC1=CC=CC=C1)C=2C=C(C=CC2)C=3NC(=O)C=CC3
Synonyms:- 6-[3-(Phenylmethoxy)phenyl]-2(1H)-pyridinone
- 2(1H)-Pyridinone, 6-[3-(phenylmethoxy)phenyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.