
CAS 1111110-98-5
:6-(3,5-Dimethylphenyl)-2(1H)-pyridinone
Description:
6-(3,5-Dimethylphenyl)-2(1H)-pyridinone is an organic compound characterized by its pyridinone structure, which features a pyridine ring fused with a carbonyl group. The presence of the 3,5-dimethylphenyl substituent contributes to its unique properties, including potential hydrophobicity and increased lipophilicity due to the bulky aromatic group. This compound may exhibit various biological activities, making it of interest in medicinal chemistry and drug development. Its molecular structure suggests potential interactions with biological targets, possibly influencing enzyme activity or receptor binding. The compound's solubility, stability, and reactivity can be influenced by the substituents on the pyridine ring and the phenyl group. Additionally, the presence of the carbonyl group may allow for hydrogen bonding interactions, affecting its behavior in different solvents. Overall, 6-(3,5-Dimethylphenyl)-2(1H)-pyridinone is a versatile compound with potential applications in pharmaceuticals and organic synthesis, although specific properties such as melting point, boiling point, and spectral data would require experimental determination or literature reference for precise characterization.
Formula:C13H13NO
InChI:InChI=1S/C13H13NO/c1-9-6-10(2)8-11(7-9)12-4-3-5-13(15)14-12/h3-8H,1-2H3,(H,14,15)
InChI key:InChIKey=LSTMZBNQRFGYDT-UHFFFAOYSA-N
SMILES:CC=1C=C(C=C(C)C1)C=2NC(=O)C=CC2
Synonyms:- 2(1H)-Pyridinone, 6-(3,5-dimethylphenyl)-
- 6-(3,5-Dimethylphenyl)-2(1H)-pyridinone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.