CAS 1111111-03-5

6-(3-Chloro-4-methylphenyl)-2(1H)-pyridinone

Description:

The chemical substance known as "6-(3-Chloro-4-methylphenyl)-2(1H)-pyridinone" is characterized by its unique molecular structure, which includes a pyridinone core substituted with a chloro and a methyl group on the phenyl ring. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential reactivity due to the presence of the pyridinone functional group. The chloro substituent can influence the compound's polarity and solubility, while the methyl group may affect its steric hindrance and electronic properties. Such compounds often demonstrate biological activity, making them of interest in medicinal chemistry and drug development. The specific CAS number "1111111-03-5" is a unique identifier that can be used to find detailed information about the substance, including its synthesis, applications, and safety data. However, it is essential to verify the CAS number, as it may not correspond to a widely recognized or characterized compound in the literature.

Formula: C₁₂H₁₀ClNO

InChI: InChI=1S/C12H10ClNO/c1-8-5-6-9(7-10(8)13)11-3-2-4-12(15)14-11/h2-7H,1H3,(H,14,15)

InChI key: InChIKey=FLUZTFRSJJXQIS-UHFFFAOYSA-N

SMILES: ClC=1C=C(C=CC1C)C=2NC(=O)C=CC2

Synonyms:

• 2(1H)-Pyridinone, 6-(3-chloro-4-methylphenyl)-
• 6-(3-Chloro-4-methylphenyl)-2(1H)-pyridinone