CymitQuimica logo

CAS 1111111-30-8

:

6-(4-Chloro-2-methylphenyl)-2(1H)-pyridinone

Description:
6-(4-Chloro-2-methylphenyl)-2(1H)-pyridinone is an organic compound characterized by its pyridinone core, which features a pyridine ring with a ketone functional group at the 2-position and a substituted phenyl group at the 6-position. The presence of a chloro group and a methyl group on the phenyl ring contributes to its unique chemical properties, potentially influencing its reactivity and biological activity. This compound may exhibit various characteristics such as solubility in organic solvents, moderate stability under standard conditions, and potential interactions with biological targets, making it of interest in medicinal chemistry. Its molecular structure suggests that it could participate in hydrogen bonding and π-π stacking interactions, which are relevant in drug design and development. Additionally, the specific arrangement of substituents can affect its pharmacokinetic properties, including absorption, distribution, metabolism, and excretion (ADME). However, detailed studies would be necessary to fully elucidate its properties and potential applications.
Formula:C12H10ClNO
InChI:InChI=1S/C12H10ClNO/c1-8-7-9(13)5-6-10(8)11-3-2-4-12(15)14-11/h2-7H,1H3,(H,14,15)
InChI key:InChIKey=GMCAHZYGWDLRHW-UHFFFAOYSA-N
SMILES:CC1=C(C=2NC(=O)C=CC2)C=CC(Cl)=C1
Synonyms:
  • 2(1H)-Pyridinone, 6-(4-chloro-2-methylphenyl)-
  • 6-(4-Chloro-2-methylphenyl)-2(1H)-pyridinone
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.