CAS 1111111-62-6

6-(4-Ethoxy-2-methylphenyl)-2(1H)-pyridinone

Description:

The chemical substance known as "6-(4-Ethoxy-2-methylphenyl)-2(1H)-pyridinone" is characterized by its unique molecular structure, which includes a pyridinone core substituted with an ethoxy and a methylphenyl group. This compound typically exhibits properties such as moderate solubility in organic solvents, which is common for many pyridinone derivatives. The presence of the ethoxy group can influence its reactivity and polarity, potentially enhancing its lipophilicity. Additionally, the compound may display biological activity, making it of interest in pharmaceutical research. Its molecular interactions can be influenced by the functional groups present, which may affect its binding affinity to biological targets. The specific CAS number provided, "1111111-62-6," is a unique identifier that can be used to find more detailed information about the substance, including its synthesis, applications, and safety data. However, it is important to verify the CAS number as it may not correspond to a widely recognized or characterized compound in the literature.

Formula: C₁₄H₁₅NO₂

InChI: InChI=1S/C14H15NO2/c1-3-17-11-7-8-12(10(2)9-11)13-5-4-6-14(16)15-13/h4-9H,3H2,1-2H3,(H,15,16)

InChI key: InChIKey=XEPGVVQFTPFVFB-UHFFFAOYSA-N

SMILES: CC1=C(C=2NC(=O)C=CC2)C=CC(OCC)=C1

Synonyms:

• 6-(4-Ethoxy-2-methylphenyl)-2(1H)-pyridinone
• 2(1H)-Pyridinone, 6-(4-ethoxy-2-methylphenyl)-