
CAS 1111111-73-9
:6-(2-Fluoro-3-methoxyphenyl)-2(1H)-pyridinone
Description:
The chemical substance known as "6-(2-Fluoro-3-methoxyphenyl)-2(1H)-pyridinone" is characterized by its unique molecular structure, which includes a pyridinone core substituted with a fluoro and methoxy group on the phenyl ring. This compound typically exhibits properties such as moderate solubility in organic solvents and potential bioactivity due to the presence of the pyridinone moiety, which is often associated with various pharmacological activities. The fluorine atom can influence the compound's electronic properties and lipophilicity, potentially enhancing its biological interactions. Additionally, the methoxy group may contribute to the compound's stability and reactivity. As with many organic compounds, its behavior in different environments, such as in aqueous solutions or under varying pH conditions, can significantly affect its stability and reactivity. The specific applications and uses of this compound would depend on its biological activity and the context of its use in research or industry. Always consult relevant safety data and literature for detailed handling and application information.
Formula:C12H10FNO2
InChI:InChI=1S/C12H10FNO2/c1-16-10-6-2-4-8(12(10)13)9-5-3-7-11(15)14-9/h2-7H,1H3,(H,14,15)
InChI key:InChIKey=JNLQUZFOBMRGHM-UHFFFAOYSA-N
SMILES:FC1=C(C=CC=C1OC)C=2NC(=O)C=CC2
Synonyms:- 2(1H)-Pyridinone, 6-(2-fluoro-3-methoxyphenyl)-
- 6-(2-Fluoro-3-methoxyphenyl)-2(1H)-pyridinone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.