CAS 1111112-95-8

6-(2-Fluoro-4-methoxyphenyl)-2(1H)-pyridinone

Description:

6-(2-Fluoro-4-methoxyphenyl)-2(1H)-pyridinone is an organic compound characterized by its pyridinone core, which features a fluorinated and methoxy-substituted phenyl group. The presence of the fluorine atom enhances the compound's lipophilicity and may influence its biological activity, while the methoxy group can affect its electronic properties and solubility. The pyridinone structure contributes to its potential as a chelating agent or in medicinal chemistry, where it may exhibit various pharmacological activities. This compound is likely to be a solid at room temperature, with moderate stability under standard conditions. Its reactivity may include participation in nucleophilic substitutions or coordination with metal ions, depending on the functional groups present. The specific interactions and applications of this compound would depend on its precise molecular structure and the context in which it is used, such as in drug development or as a chemical intermediate. Further studies would be necessary to elucidate its full range of properties and potential applications.

Formula: C₁₂H₁₀FNO₂

InChI: InChI=1S/C12H10FNO2/c1-16-8-5-6-9(10(13)7-8)11-3-2-4-12(15)14-11/h2-7H,1H3,(H,14,15)

InChI key: InChIKey=ITYIUQVEWNYKOU-UHFFFAOYSA-N

SMILES: FC1=C(C=2NC(=O)C=CC2)C=CC(OC)=C1

Synonyms:

• 6-(2-Fluoro-4-methoxyphenyl)-2(1H)-pyridinone
• 2(1H)-Pyridinone, 6-(2-fluoro-4-methoxyphenyl)-