
CAS 1111113-21-3
:5-(2-Fluoro-3-methoxyphenyl)-2(1H)-pyrimidinone
Description:
5-(2-Fluoro-3-methoxyphenyl)-2(1H)-pyrimidinone is a chemical compound characterized by its pyrimidinone core, which features a fluorinated and methoxy-substituted phenyl group. The presence of the fluorine atom typically enhances the compound's lipophilicity and may influence its biological activity, while the methoxy group can affect solubility and reactivity. This compound is likely to exhibit properties common to pyrimidinones, such as potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting various biological pathways. The structural features suggest that it may interact with specific biological targets, making it of interest in drug discovery. Additionally, the compound's stability, solubility, and reactivity can be influenced by the electronic effects of the substituents on the aromatic ring and the heterocyclic pyrimidinone moiety. Overall, 5-(2-Fluoro-3-methoxyphenyl)-2(1H)-pyrimidinone represents a class of compounds that may have significant implications in therapeutic applications, pending further investigation into its pharmacological properties.
Formula:C11H9FN2O2
InChI:InChI=1S/C11H9FN2O2/c1-16-9-4-2-3-8(10(9)12)7-5-13-11(15)14-6-7/h2-6H,1H3,(H,13,14,15)
InChI key:InChIKey=LKRZYTYDJCAZCU-UHFFFAOYSA-N
SMILES:FC1=C(C=CC=C1OC)C2=CNC(=O)N=C2
Synonyms:- 2(1H)-Pyrimidinone, 5-(2-fluoro-3-methoxyphenyl)-
- 5-(2-Fluoro-3-methoxyphenyl)-2(1H)-pyrimidinone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.