
CAS 1111113-74-6
:5-(3-Thienyl)-2(1H)-pyrimidinone
Description:
5-(3-Thienyl)-2(1H)-pyrimidinone is a heterocyclic organic compound characterized by the presence of both a pyrimidinone and a thienyl group. The pyrimidinone moiety features a six-membered ring containing two nitrogen atoms at the 1 and 3 positions, contributing to its aromaticity and potential for hydrogen bonding. The thienyl group, derived from thiophene, introduces sulfur into the structure, which can influence the compound's electronic properties and reactivity. This compound may exhibit biological activity, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. Its solubility, stability, and reactivity can vary based on the functional groups present and the overall molecular structure. Additionally, the compound's properties, such as melting point, boiling point, and spectral characteristics, would be determined through experimental methods. Overall, 5-(3-Thienyl)-2(1H)-pyrimidinone represents a class of compounds that can be explored for various applications in organic synthesis and drug development.
Formula:C8H6N2OS
InChI:InChI=1S/C8H6N2OS/c11-8-9-3-7(4-10-8)6-1-2-12-5-6/h1-5H,(H,9,10,11)
InChI key:InChIKey=LVSXKHUUGPIHCV-UHFFFAOYSA-N
SMILES:O=C1NC=C(C=N1)C=2C=CSC2
Synonyms:- 5-(3-Thienyl)-2(1H)-pyrimidinone
- 2(1H)-Pyrimidinone, 5-(3-thienyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.