
CAS 1111113-76-8
:5-(3,5-Dichlorophenyl)-2(1H)-pyrimidinone
Description:
5-(3,5-Dichlorophenyl)-2(1H)-pyrimidinone is a chemical compound characterized by its pyrimidinone core, which features a dichlorophenyl substituent. This structure contributes to its potential biological activity, making it of interest in medicinal chemistry. The presence of the dichlorophenyl group enhances lipophilicity and may influence the compound's interaction with biological targets. The compound typically exhibits solid-state properties at room temperature and may be soluble in organic solvents, depending on its specific formulation and purity. Its molecular structure suggests potential applications in pharmaceuticals, particularly in the development of agents targeting various diseases. The compound's reactivity can be influenced by the functional groups present, and it may undergo typical organic reactions such as nucleophilic substitutions or electrophilic additions. Safety and handling precautions are essential, as with many chemical substances, due to potential toxicity or environmental impact. Further studies would be necessary to fully elucidate its pharmacological properties and mechanisms of action.
Formula:C10H6Cl2N2O
InChI:InChI=1S/C10H6Cl2N2O/c11-8-1-6(2-9(12)3-8)7-4-13-10(15)14-5-7/h1-5H,(H,13,14,15)
InChI key:InChIKey=AMQOHVGCWJXNLB-UHFFFAOYSA-N
SMILES:ClC=1C=C(C=C(Cl)C1)C2=CNC(=O)N=C2
Synonyms:- 5-(3,5-Dichlorophenyl)-2(1H)-pyrimidinone
- 2(1H)-Pyrimidinone, 5-(3,5-dichlorophenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.