CAS 1111114-36-3

2-(1,6-Dihydro-6-oxo-2-pyridinyl)benzaldehyde

Description:

2-(1,6-Dihydro-6-oxo-2-pyridinyl)benzaldehyde is an organic compound characterized by its unique structure, which features a benzaldehyde moiety attached to a pyridine derivative. This compound typically exhibits a yellow to brown color and is soluble in organic solvents such as ethanol and dimethyl sulfoxide (DMSO). The presence of the aldehyde functional group contributes to its reactivity, allowing it to participate in various chemical reactions, including condensation and oxidation. The pyridine ring adds to its aromatic character and can influence its biological activity, making it of interest in medicinal chemistry. Additionally, the compound may exhibit fluorescence properties, which can be useful in analytical applications. Its potential applications span across pharmaceuticals, agrochemicals, and materials science, where it may serve as an intermediate or a building block for more complex molecules. As with many organic compounds, handling should be done with care, considering safety data and potential hazards associated with its use.

Formula: C₁₂H₉NO₂

InChI: InChI=1S/C12H9NO2/c14-8-9-4-1-2-5-10(9)11-6-3-7-12(15)13-11/h1-8H,(H,13,15)

InChI key: InChIKey=SQKYFERLIAEJFT-UHFFFAOYSA-N

SMILES: C(=O)C1=C(C=CC=C1)C=2NC(=O)C=CC2

Synonyms:

• Benzaldehyde, 2-(1,6-dihydro-6-oxo-2-pyridinyl)-
• 2-(1,6-Dihydro-6-oxo-2-pyridinyl)benzaldehyde