
CAS 1111114-64-7
:6-[4-(Hydroxymethyl)phenyl]-2(1H)-pyridinone
Description:
6-[4-(Hydroxymethyl)phenyl]-2(1H)-pyridinone, identified by its CAS number 1111114-64-7, is an organic compound characterized by its pyridinone core structure, which features a hydroxymethyl-substituted phenyl group at the 6-position. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, including potential solubility in polar solvents due to the presence of the hydroxymethyl group. The hydroxymethyl group can participate in hydrogen bonding, influencing its reactivity and interactions with other molecules. Additionally, the pyridinone moiety may exhibit tautomerism, existing in both keto and enol forms, which can affect its chemical behavior and stability. This compound may also demonstrate biological activity, making it of interest in medicinal chemistry and drug development. Its specific applications and reactivity would depend on the functional groups present and the overall molecular structure, which can influence its interactions in various chemical environments.
Formula:C12H11NO2
InChI:InChI=1S/C12H11NO2/c14-8-9-4-6-10(7-5-9)11-2-1-3-12(15)13-11/h1-7,14H,8H2,(H,13,15)
InChI key:InChIKey=UUFWHVPRPBHFKS-UHFFFAOYSA-N
SMILES:O=C1NC(=CC=C1)C2=CC=C(CO)C=C2
Synonyms:- 2(1H)-Pyridinone, 6-[4-(hydroxymethyl)phenyl]-
- 6-[4-(Hydroxymethyl)phenyl]-2(1H)-pyridinone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.