CAS 1111114-73-8

6-Cyclopentyl-2(1H)-pyridinone

Description:

6-Cyclopentyl-2(1H)-pyridinone is a chemical compound characterized by its pyridinone structure, which features a pyridine ring fused with a carbonyl group and a cyclopentyl substituent. This compound typically exhibits properties associated with heterocyclic compounds, including potential biological activity due to the presence of the nitrogen atom in the pyridine ring. The cyclopentyl group can influence the compound's lipophilicity and steric properties, potentially affecting its interaction with biological targets. It may be soluble in organic solvents and exhibit moderate stability under standard conditions. The compound's unique structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as derivatives of pyridinones are often explored for their therapeutic properties. However, specific data regarding its reactivity, toxicity, and detailed physical properties would require further investigation or empirical studies. As with any chemical substance, safety precautions should be observed when handling it in a laboratory setting.

Formula: C₁₀H₁₃NO

InChI: InChI=1S/C10H13NO/c12-10-7-3-6-9(11-10)8-4-1-2-5-8/h3,6-8H,1-2,4-5H2,(H,11,12)

InChI key: InChIKey=HRMCRWHDCMKEPU-UHFFFAOYSA-N

SMILES: O=C1NC(=CC=C1)C2CCCC2

Synonyms:

• 2(1H)-Pyridinone, 6-cyclopentyl-
• 6-Cyclopentyl-2(1H)-pyridinone