CAS 1111114-75-0

6-(3,5-Dichlorophenyl)-2(1H)-pyridinone

Description:

6-(3,5-Dichlorophenyl)-2(1H)-pyridinone, identified by its CAS number 1111114-75-0, is an organic compound characterized by its pyridinone structure, which features a pyridine ring with a ketone functional group. The presence of the 3,5-dichlorophenyl substituent indicates that the compound has two chlorine atoms attached to a phenyl ring, which can significantly influence its chemical properties, including its reactivity and solubility. This compound may exhibit biological activity, making it of interest in pharmaceutical research. Its molecular structure suggests potential interactions with biological targets, possibly leading to applications in medicinal chemistry. Additionally, the presence of halogen atoms often enhances lipophilicity, which can affect the compound's absorption and distribution in biological systems. As with many organic compounds, the stability, solubility, and reactivity of 6-(3,5-Dichlorophenyl)-2(1H)-pyridinone can be influenced by environmental factors such as pH and temperature. Safety and handling precautions should be observed due to the presence of chlorine, which can pose health risks.

Formula: C₁₁H₇Cl₂NO

InChI: InChI=1S/C11H7Cl2NO/c12-8-4-7(5-9(13)6-8)10-2-1-3-11(15)14-10/h1-6H,(H,14,15)

InChI key: InChIKey=OLJPWCQALHJENO-UHFFFAOYSA-N

SMILES: ClC=1C=C(C=C(Cl)C1)C=2NC(=O)C=CC2

Synonyms:

• 2(1H)-Pyridinone, 6-(3,5-dichlorophenyl)-
• 6-(3,5-Dichlorophenyl)-2(1H)-pyridinone