CAS 1111115-33-3

5-(4-Ethoxy-2-methylphenyl)-2(1H)-pyridinone

Description:

5-(4-Ethoxy-2-methylphenyl)-2(1H)-pyridinone is an organic compound characterized by its unique molecular structure, which includes a pyridinone ring and an ethoxy-substituted aromatic group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential reactivity due to the presence of the pyridinone moiety. The ethoxy group contributes to its solubility in organic solvents and may influence its biological activity. The presence of the methyl group on the aromatic ring can affect the compound's electronic properties and steric hindrance, potentially impacting its interactions in chemical reactions or biological systems. As with many organic compounds, its characteristics, including melting point, boiling point, and solubility, can vary based on environmental conditions and the presence of other substances. This compound may have applications in pharmaceuticals or materials science, but specific uses would depend on further research into its biological activity and chemical behavior.

Formula: C₁₄H₁₅NO₂

InChI: InChI=1S/C14H15NO2/c1-3-17-12-5-6-13(10(2)8-12)11-4-7-14(16)15-9-11/h4-9H,3H2,1-2H3,(H,15,16)

InChI key: InChIKey=BWBDZEWFUZOETK-UHFFFAOYSA-N

SMILES: CC1=C(C=CC(OCC)=C1)C=2C=CC(=O)NC2

Synonyms:

• 2(1H)-Pyridinone, 5-(4-ethoxy-2-methylphenyl)-
• 5-(4-Ethoxy-2-methylphenyl)-2(1H)-pyridinone