CymitQuimica logo

CAS 1111115-46-8

:

5-(2-Fluoro-3-methoxyphenyl)-2(1H)-pyridinone

Description:
5-(2-Fluoro-3-methoxyphenyl)-2(1H)-pyridinone, identified by its CAS number 1111115-46-8, is a chemical compound characterized by its unique structural features that include a pyridinone core and a substituted phenyl group. The presence of a fluorine atom and a methoxy group on the phenyl ring contributes to its chemical reactivity and potential biological activity. This compound may exhibit properties such as lipophilicity due to the aromatic systems, which can influence its solubility and permeability in biological systems. The pyridinone moiety is often associated with various pharmacological activities, making this compound of interest in medicinal chemistry. Additionally, the specific arrangement of substituents can affect its interaction with biological targets, potentially leading to applications in drug development. As with many organic compounds, its stability, reactivity, and potential applications would depend on the specific conditions under which it is studied, including solvent, temperature, and the presence of other reagents.
Formula:C12H10FNO2
InChI:InChI=1S/C12H10FNO2/c1-16-10-4-2-3-9(12(10)13)8-5-6-11(15)14-7-8/h2-7H,1H3,(H,14,15)
InChI key:InChIKey=AGPOXGMXOONIHC-UHFFFAOYSA-N
SMILES:FC1=C(C=CC=C1OC)C=2C=CC(=O)NC2
Synonyms:
  • 2(1H)-Pyridinone, 5-(2-fluoro-3-methoxyphenyl)-
  • 5-(2-Fluoro-3-methoxyphenyl)-2(1H)-pyridinone
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.