
CAS 1111115-98-0
:5-[4-(Hydroxymethyl)phenyl]-2(1H)-pyridinone
Description:
5-[4-(Hydroxymethyl)phenyl]-2(1H)-pyridinone, identified by its CAS number 1111115-98-0, is an organic compound characterized by its pyridinone core structure, which features a hydroxymethyl-substituted phenyl group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, including potential solubility in polar solvents due to the presence of the hydroxymethyl group. The hydroxymethyl substituent can influence the compound's reactivity and interactions, potentially allowing for hydrogen bonding and enhancing its biological activity. The pyridinone moiety may contribute to its ability to chelate metal ions, which is a significant characteristic in various chemical and biological applications. Additionally, compounds of this type may exhibit pharmacological properties, making them of interest in medicinal chemistry. Overall, the structural features of 5-[4-(Hydroxymethyl)phenyl]-2(1H)-pyridinone suggest a versatile compound with potential applications in both research and industry.
Formula:C12H11NO2
InChI:InChI=1S/C12H11NO2/c14-8-9-1-3-10(4-2-9)11-5-6-12(15)13-7-11/h1-7,14H,8H2,(H,13,15)
InChI key:InChIKey=ZQQWBGFFVGFLMG-UHFFFAOYSA-N
SMILES:C(O)C1=CC=C(C=C1)C=2C=CC(=O)NC2
Synonyms:- 5-[4-(Hydroxymethyl)phenyl]-2(1H)-pyridinone
- 2(1H)-Pyridinone, 5-[4-(hydroxymethyl)phenyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.