CAS 1111116-05-2

5-(3-Thienyl)-2(1H)-pyridinone

Description:

5-(3-Thienyl)-2(1H)-pyridinone is an organic compound characterized by its unique structure, which includes a pyridinone ring fused with a thienyl group. This compound typically exhibits properties associated with heterocyclic compounds, such as potential biological activity and solubility in organic solvents. The presence of both sulfur in the thienyl ring and nitrogen in the pyridinone contributes to its chemical reactivity and potential interactions with biological targets. It may participate in various chemical reactions, including nucleophilic substitutions and electrophilic additions, due to the electron-rich nature of the thienyl group. Additionally, compounds of this type are often investigated for their pharmacological properties, including antimicrobial and anti-inflammatory activities. The specific characteristics, such as melting point, boiling point, and spectral data, would depend on the compound's purity and the conditions under which it is studied. Overall, 5-(3-Thienyl)-2(1H)-pyridinone represents a class of compounds with significant interest in medicinal chemistry and material science.

Formula: C₉H₇NOS

InChI: InChI=1S/C9H7NOS/c11-9-2-1-7(5-10-9)8-3-4-12-6-8/h1-6H,(H,10,11)

InChI key: InChIKey=RYYAUZRVKSNJEF-UHFFFAOYSA-N

SMILES: O=C1C=CC(=CN1)C=2C=CSC2

Synonyms:

• 5-(3-Thienyl)-2(1H)-pyridinone
• 2(1H)-Pyridinone, 5-(3-thienyl)-